C32H37NO8 — CID 139148739
2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-dimethylazanium (PubChem CID 139148739) has the molecular formula C32H37NO8 and a molecular weight of 563.65 g/mol. Its IUPAC name is 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-dimethylazanium.
| Compound Name | 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 139148739 |
| Molecular Formula | C32H37NO8 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-dimethylazanium |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCC[NH+](C)C)cc1)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C26H29NO.C6H8O7/c1-4-25(21-11-7-5-8-12-21)26(22-13-9-6-10-14-22)23-15-17-24(18-16-23)28-20-19-27(2)3;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-18H,4,19-20H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b26-25-; |
| InChIKey | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| XLogP | 2.00 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|