C54H58N2O2 — CID 139150123
3,6-ditert-butyl-1-isoquinolin-1-ylnaphthalen-2-ol (PubChem CID 139150123) has the molecular formula C54H58N2O2 and a molecular weight of 767.07 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-isoquinolin-1-ylnaphthalen-2-ol.
| Compound Name | 3,6-ditert-butyl-1-isoquinolin-1-ylnaphthalen-2-ol |
|---|---|
| PubChem CID | 139150123 |
| Molecular Formula | C54H58N2O2 |
| Molecular Weight | 767.07 g/mol |
| Exact Mass | 766.45 |
| IUPAC Name | 3,6-ditert-butyl-1-isoquinolin-1-ylnaphthalen-2-ol |
| SMILES | CC(C)(C)c1ccc2c(-c3nccc4ccccc34)c(O)c(C(C)(C)C)cc2c1.CC(C)(C)c1ccc2c(-c3nccc4ccccc34)c(O)c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/2C27H29NO/c2*1-26(2,3)19-11-12-20-18(15-19)16-22(27(4,5)6)25(29)23(20)24-21-10-8-7-9-17(21)13-14-28-24/h2*7-16,29H,1-6H3 |
| InChIKey | BXDILTLRJNFISB-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.07 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |