C40H52N4O2Zn — CID 139150484
zinc;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;1-methylimidazole (PubChem CID 139150484) has the molecular formula C40H52N4O2Zn and a molecular weight of 686.27 g/mol. Its IUPAC name is zinc;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;1-methylimidazole.
| Compound Name | zinc;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;1-methylimidazole |
|---|---|
| PubChem CID | 139150484 |
| Molecular Formula | C40H52N4O2Zn |
| Molecular Weight | 686.27 g/mol |
| Exact Mass | 684.34 |
| IUPAC Name | zinc;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;1-methylimidazole |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.Cn1ccnc1.[Zn+2] |
| InChI | InChI=1S/C36H48N2O2.C4H6N2.Zn/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;1-6-3-2-5-4-6;/h13-22,39-40H,1-12H3;2-4H,1H3;/q;;+2/p-2/b37-21+,38-22+;; |
| InChIKey | BAKMKRJQGNKUOT-XIDIDSRISA-L |
| XLogP | 8.94 |
| TPSA | 88.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.27 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|