About boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide
boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide (PubChem CID 139152181) has the molecular formula C45H38B2FeN6
and a molecular weight of 740.31 g/mol. Its IUPAC name is boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide.
Molecular Properties
| Compound Name | boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide |
| PubChem CID | 139152181 |
| Molecular Formula | C45H38B2FeN6 |
| Molecular Weight | 740.31 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide |
| SMILES | [BH4-].[Fe+2].c1ccc(-c2cc(-c3ccccc3)n([BH-](n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H34BN6.BH4.Fe/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36;;/h1-33,46H;1H4;/q2*-1;+2 |
| InChIKey | REAWGSWJMNPFJY-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 740.31 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide?
The IUPAC name of boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide (CID 139152181) is boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide.
What is the SMILES notation for boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide?
The canonical SMILES for boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide is [BH4-].[Fe+2].c1ccc(-c2cc(-c3ccccc3)n([BH-](n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1.
What is the InChIKey of boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide?
The InChIKey is REAWGSWJMNPFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H34BN6.BH4.Fe/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36;;/h1-33,46H;1H4;/q2*-1;+2.
What are the key properties of boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide?
boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide has a molecular weight of 740.31 g/mol, XLogP of 8.49, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for boranuide;iron(2+);tris(3,5-diphenylpyrazol-1-yl)boranuide is sourced from PubChem (CID 139152181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).