About bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate
bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate (PubChem CID 139152324) has the molecular formula C42H54N4O3
and a molecular weight of 662.92 g/mol. Its IUPAC name is bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate.
Molecular Properties
| Compound Name | bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate |
| PubChem CID | 139152324 |
| Molecular Formula | C42H54N4O3 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.42 |
| IUPAC Name | bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate |
| SMILES | CC(C)(C)c1cc(-c2nc3ccccc3[nH]2)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(-c2nc3ccccc3[nH]2)c(O)c(C(C)(C)C)c1.O |
| InChI | InChI=1S/2C21H26N2O.H2O/c2*1-20(2,3)13-11-14(18(24)15(12-13)21(4,5)6)19-22-16-9-7-8-10-17(16)23-19;/h2*7-12,24H,1-6H3,(H,22,23);1H2 |
| InChIKey | FRSUIBFZZSOJCW-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate?
The IUPAC name of bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate (CID 139152324) is bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate.
What is the SMILES notation for bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate?
The canonical SMILES for bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate is CC(C)(C)c1cc(-c2nc3ccccc3[nH]2)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(-c2nc3ccccc3[nH]2)c(O)c(C(C)(C)C)c1.O.
What is the InChIKey of bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate?
The InChIKey is FRSUIBFZZSOJCW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H26N2O.H2O/c2*1-20(2,3)13-11-14(18(24)15(12-13)21(4,5)6)19-22-16-9-7-8-10-17(16)23-19;/h2*7-12,24H,1-6H3,(H,22,23);1H2.
What are the key properties of bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate?
bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate has a molecular weight of 662.92 g/mol, XLogP of 10.24, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(1H-benzimidazol-2-yl)-4,6-ditert-butylphenol);hydrate is sourced from PubChem (CID 139152324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).