C52H39BN6O3Zn — CID 139154022
zinc;4-methyl-3,6-dioxocyclohexa-1,4-dien-1-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide (PubChem CID 139154022) has the molecular formula C52H39BN6O3Zn and a molecular weight of 872.13 g/mol. Its IUPAC name is zinc;4-methyl-3,6-dioxocyclohexa-1,4-dien-1-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide.
| Compound Name | zinc;4-methyl-3,6-dioxocyclohexa-1,4-dien-1-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide |
|---|---|
| PubChem CID | 139154022 |
| Molecular Formula | C52H39BN6O3Zn |
| Molecular Weight | 872.13 g/mol |
| Exact Mass | 870.25 |
| IUPAC Name | zinc;4-methyl-3,6-dioxocyclohexa-1,4-dien-1-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide |
| SMILES | CC1=CC(=O)C([O-])=CC1=O.[Zn+2].c1ccc(-c2cc(-c3ccccc3)n([BH-](n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H34BN6.C7H6O3.Zn/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36;1-4-2-6(9)7(10)3-5(4)8;/h1-33,46H;2-3,10H,1H3;/q-1;;+2/p-1 |
| InChIKey | LMDJRYDVQJUPPK-UHFFFAOYSA-M |
| XLogP | 9.27 |
| TPSA | 110.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.13 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|