C36H64B2CrN8 — CID 139154857
bis(bis[3,5-di(propan-2-yl)pyrazol-1-yl]boranuide);chromium(2+) (PubChem CID 139154857) has the molecular formula C36H64B2CrN8 and a molecular weight of 682.58 g/mol. Its IUPAC name is bis(bis[3,5-di(propan-2-yl)pyrazol-1-yl]boranuide);chromium(2+).
| Compound Name | bis(bis[3,5-di(propan-2-yl)pyrazol-1-yl]boranuide);chromium(2+) |
|---|---|
| PubChem CID | 139154857 |
| Molecular Formula | C36H64B2CrN8 |
| Molecular Weight | 682.58 g/mol |
| Exact Mass | 682.48 |
| IUPAC Name | bis(bis[3,5-di(propan-2-yl)pyrazol-1-yl]boranuide);chromium(2+) |
| SMILES | CC(C)c1cc(C(C)C)n([BH2-]n2nc(C(C)C)cc2C(C)C)n1.CC(C)c1cc(C(C)C)n([BH2-]n2nc(C(C)C)cc2C(C)C)n1.[Cr+2] |
| InChI | InChI=1S/2C18H32BN4.Cr/c2*1-11(2)15-9-17(13(5)6)22(20-15)19-23-18(14(7)8)10-16(21-23)12(3)4;/h2*9-14H,19H2,1-8H3;/q2*-1;+2 |
| InChIKey | QRAXAVCTOJECEG-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.58 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|