About 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one
2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one (PubChem CID 139155419) has the molecular formula C32H36O2
and a molecular weight of 452.64 g/mol. Its IUPAC name is 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one.
Molecular Properties
| Compound Name | 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one |
| PubChem CID | 139155419 |
| Molecular Formula | C32H36O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one |
| SMILES | CC(C)(C)c1ccc(O)c(C(C)(C)C)c1.O=C1/C(=C2\CCc3ccccc32)Cc2ccccc21 |
| InChI | InChI=1S/C18H14O.C14H22O/c19-18-15-8-4-2-6-13(15)11-17(18)16-10-9-12-5-1-3-7-14(12)16;1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h1-8H,9-11H2;7-9,15H,1-6H3/b17-16+; |
| InChIKey | KYSXOWNHUJWRNH-CMBBICFISA-N |
| XLogP | 7.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one?
The IUPAC name of 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one (CID 139155419) is 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one.
What is the SMILES notation for 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one?
The canonical SMILES for 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one is CC(C)(C)c1ccc(O)c(C(C)(C)C)c1.O=C1/C(=C2\CCc3ccccc32)Cc2ccccc21.
What is the InChIKey of 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one?
The InChIKey is KYSXOWNHUJWRNH-CMBBICFISA-N. The full InChI is InChI=1S/C18H14O.C14H22O/c19-18-15-8-4-2-6-13(15)11-17(18)16-10-9-12-5-1-3-7-14(12)16;1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h1-8H,9-11H2;7-9,15H,1-6H3/b17-16+;.
What are the key properties of 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one?
2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one has a molecular weight of 452.64 g/mol, XLogP of 7.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butylphenol;(2E)-2-(2,3-dihydroinden-1-ylidene)-3H-inden-1-one is sourced from PubChem (CID 139155419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).