About copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate
copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate (PubChem CID 139155740) has the molecular formula C15H19CuN3O2
and a molecular weight of 336.88 g/mol. Its IUPAC name is copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate.
Molecular Properties
| Compound Name | copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate |
| PubChem CID | 139155740 |
| Molecular Formula | C15H19CuN3O2 |
| Molecular Weight | 336.88 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate |
| SMILES | CC(/C=C(\[O-])c1ccccc1)=N\CCN(C)C.[Cu+2].[N-]=C=O |
| InChI | InChI=1S/C14H20N2O.CNO.Cu/c1-12(15-9-10-16(2)3)11-14(17)13-7-5-4-6-8-13;2-1-3;/h4-8,11,17H,9-10H2,1-3H3;;/q;-1;+2/p-1/b14-11-,15-12+;; |
| InChIKey | SNWZJKAOAJFBAY-LTXLZYJVSA-M |
| XLogP | 1.30 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.88 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate?
The IUPAC name of copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate (CID 139155740) is copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate.
What is the SMILES notation for copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate?
The canonical SMILES for copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate is CC(/C=C(\[O-])c1ccccc1)=N\CCN(C)C.[Cu+2].[N-]=C=O.
What is the InChIKey of copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate?
The InChIKey is SNWZJKAOAJFBAY-LTXLZYJVSA-M. The full InChI is InChI=1S/C14H20N2O.CNO.Cu/c1-12(15-9-10-16(2)3)11-14(17)13-7-5-4-6-8-13;2-1-3;/h4-8,11,17H,9-10H2,1-3H3;;/q;-1;+2/p-1/b14-11-,15-12+;;.
What are the key properties of copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate?
copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate has a molecular weight of 336.88 g/mol, XLogP of 1.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(Z)-3-[2-(dimethylamino)ethylimino]-1-phenylbut-1-en-1-olate;isocyanate is sourced from PubChem (CID 139155740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).