About 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride
2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride (PubChem CID 139156597) has the molecular formula C10H25Cl2N3
and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride.
Molecular Properties
| Compound Name | 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride |
| PubChem CID | 139156597 |
| Molecular Formula | C10H25Cl2N3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride |
| SMILES | C[NH+](C)CCN1CC[N+](C)(C)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C10H24N3.2ClH/c1-11(2)5-6-12-7-9-13(3,4)10-8-12;;/h5-10H2,1-4H3;2*1H/q+1;;/p-1 |
| InChIKey | PKZZJWOKPNKOSO-UHFFFAOYSA-M |
| XLogP | -7.47 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride?
The IUPAC name of 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride (CID 139156597) is 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride.
What is the SMILES notation for 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride?
The canonical SMILES for 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride is C[NH+](C)CCN1CC[N+](C)(C)CC1.[Cl-].[Cl-].
What is the InChIKey of 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride?
The InChIKey is PKZZJWOKPNKOSO-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H24N3.2ClH/c1-11(2)5-6-12-7-9-13(3,4)10-8-12;;/h5-10H2,1-4H3;2*1H/q+1;;/p-1.
What are the key properties of 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride?
2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride has a molecular weight of 258.24 g/mol, XLogP of -7.47, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl-dimethylazanium dichloride is sourced from PubChem (CID 139156597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).