C26H29AsCl2O2 — CID 139156863
[2,6-bis[(2,4,6-trimethylphenoxy)methyl]phenyl]-dichloroarsane (PubChem CID 139156863) has the molecular formula C26H29AsCl2O2 and a molecular weight of 519.34 g/mol. Its IUPAC name is [2,6-bis[(2,4,6-trimethylphenoxy)methyl]phenyl]-dichloroarsane.
| Compound Name | [2,6-bis[(2,4,6-trimethylphenoxy)methyl]phenyl]-dichloroarsane |
|---|---|
| PubChem CID | 139156863 |
| Molecular Formula | C26H29AsCl2O2 |
| Molecular Weight | 519.34 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | [2,6-bis[(2,4,6-trimethylphenoxy)methyl]phenyl]-dichloroarsane |
| SMILES | Cc1cc(C)c(OCc2cccc(COc3c(C)cc(C)cc3C)c2[As](Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C26H29AsCl2O2/c1-16-10-18(3)25(19(4)11-16)30-14-22-8-7-9-23(24(22)27(28)29)15-31-26-20(5)12-17(2)13-21(26)6/h7-13H,14-15H2,1-6H3 |
| InChIKey | IRBXMTGHQTXTIX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.34 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|