C12H24N4O4 — CID 139157707
(2S)-2-[2-[2-[2-(1-carboxyethylideneamino)ethylamino]ethylamino]ethylamino]propanoic acid (PubChem CID 139157707) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-2-[2-[2-[2-(1-carboxyethylideneamino)ethylamino]ethylamino]ethylamino]propanoic acid.
| Compound Name | (2S)-2-[2-[2-[2-(1-carboxyethylideneamino)ethylamino]ethylamino]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 139157707 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2S)-2-[2-[2-[2-(1-carboxyethylideneamino)ethylamino]ethylamino]ethylamino]propanoic acid |
| SMILES | C/C(=N\CCNCCNCCN[C@@H](C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H24N4O4/c1-9(11(17)18)15-7-5-13-3-4-14-6-8-16-10(2)12(19)20/h9,13-15H,3-8H2,1-2H3,(H,17,18)(H,19,20)/b16-10+/t9-/m0/s1 |
| InChIKey | CLFPVQLVGNKVAL-RKMZRFOKSA-N |
| XLogP | -1.23 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|