C16H20B2N4 — CID 139157786
2-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)-1,3-dimethyl-1,3,2-benzodiazaborole (PubChem CID 139157786) has the molecular formula C16H20B2N4 and a molecular weight of 289.99 g/mol. Its IUPAC name is 2-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)-1,3-dimethyl-1,3,2-benzodiazaborole.
| Compound Name | 2-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)-1,3-dimethyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 139157786 |
| Molecular Formula | C16H20B2N4 |
| Molecular Weight | 289.99 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-(1,3-dimethyl-1,3,2-benzodiazaborol-2-yl)-1,3-dimethyl-1,3,2-benzodiazaborole |
| SMILES | CN1B(B2N(C)c3ccccc3N2C)N(C)c2ccccc21 |
| InChI | InChI=1S/C16H20B2N4/c1-19-13-9-5-6-10-14(13)20(2)17(19)18-21(3)15-11-7-8-12-16(15)22(18)4/h5-12H,1-4H3 |
| InChIKey | RNVVIJFLYPRMSR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.99 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|