C12H16F6N4O6S4 — CID 139158165
2-[(1,3-dimethylimidazol-1-ium-2-yl)disulfanyl]-1,3-dimethylimidazol-1-ium;bis(trifluoromethanesulfonate) (PubChem CID 139158165) has the molecular formula C12H16F6N4O6S4 and a molecular weight of 554.54 g/mol. Its IUPAC name is 2-[(1,3-dimethylimidazol-1-ium-2-yl)disulfanyl]-1,3-dimethylimidazol-1-ium;bis(trifluoromethanesulfonate).
| Compound Name | 2-[(1,3-dimethylimidazol-1-ium-2-yl)disulfanyl]-1,3-dimethylimidazol-1-ium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139158165 |
| Molecular Formula | C12H16F6N4O6S4 |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | 2-[(1,3-dimethylimidazol-1-ium-2-yl)disulfanyl]-1,3-dimethylimidazol-1-ium;bis(trifluoromethanesulfonate) |
| SMILES | Cn1cc[n+](C)c1SSc1n(C)cc[n+]1C.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H16N4S2.2CHF3O3S/c1-11-5-6-12(2)9(11)15-16-10-13(3)7-8-14(10)4;2*2-1(3,4)8(5,6)7/h5-8H,1-4H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | OBQGQDXVZSEIMQ-UHFFFAOYSA-L |
| XLogP | 0.91 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|