C76H88F8N8 — CID 139159419
1,7-bis[(3,5-difluorophenyl)methyl]-4,10-bis[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 139159419) has the molecular formula C76H88F8N8 and a molecular weight of 1265.58 g/mol. Its IUPAC name is 1,7-bis[(3,5-difluorophenyl)methyl]-4,10-bis[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,7-bis[(3,5-difluorophenyl)methyl]-4,10-bis[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 139159419 |
| Molecular Formula | C76H88F8N8 |
| Molecular Weight | 1265.58 g/mol |
| Exact Mass | 1264.70 |
| IUPAC Name | 1,7-bis[(3,5-difluorophenyl)methyl]-4,10-bis[(4-methylphenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | Cc1ccc(CN2CCN(Cc3cc(F)cc(F)c3)CCN(Cc3ccc(C)cc3)CCN(Cc3cc(F)cc(F)c3)CC2)cc1.Cc1ccc(CN2CCN(Cc3cc(F)cc(F)c3)CCN(Cc3ccc(C)cc3)CCN(Cc3cc(F)cc(F)c3)CC2)cc1 |
| InChI | InChI=1S/2C38H44F4N4/c2*1-29-3-7-31(8-4-29)25-43-11-15-45(27-33-19-35(39)23-36(40)20-33)17-13-44(26-32-9-5-30(2)6-10-32)14-18-46(16-12-43)28-34-21-37(41)24-38(42)22-34/h2*3-10,19-24H,11-18,25-28H2,1-2H3 |
| InChIKey | UGSOTHZSUISGSL-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1265.58 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |