C37H27N3O2Zn — CID 139159422
zinc;2-[[2-[(2-oxido-3-phenylphenyl)methylideneamino]phenyl]iminomethyl]-6-phenylphenolate;pyridine (PubChem CID 139159422) has the molecular formula C37H27N3O2Zn and a molecular weight of 611.03 g/mol. Its IUPAC name is zinc;2-[[2-[(2-oxido-3-phenylphenyl)methylideneamino]phenyl]iminomethyl]-6-phenylphenolate;pyridine.
| Compound Name | zinc;2-[[2-[(2-oxido-3-phenylphenyl)methylideneamino]phenyl]iminomethyl]-6-phenylphenolate;pyridine |
|---|---|
| PubChem CID | 139159422 |
| Molecular Formula | C37H27N3O2Zn |
| Molecular Weight | 611.03 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | zinc;2-[[2-[(2-oxido-3-phenylphenyl)methylideneamino]phenyl]iminomethyl]-6-phenylphenolate;pyridine |
| SMILES | [O-]c1c(/C=N/c2ccccc2/N=C/c2cccc(-c3ccccc3)c2[O-])cccc1-c1ccccc1.[Zn+2].c1ccncc1 |
| InChI | InChI=1S/C32H24N2O2.C5H5N.Zn/c35-31-25(15-9-17-27(31)23-11-3-1-4-12-23)21-33-29-19-7-8-20-30(29)34-22-26-16-10-18-28(32(26)36)24-13-5-2-6-14-24;1-2-4-6-5-3-1;/h1-22,35-36H;1-5H;/q;;+2/p-2/b33-21+,34-22+;; |
| InChIKey | YEDNRIPLBNPISL-WPBGZSBXSA-L |
| XLogP | 7.75 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.03 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|