C4H11N9O8 — CID 139159659
nitro-[3-(5-nitro-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-5-yl]azanide;tetrahydrate (PubChem CID 139159659) has the molecular formula C4H11N9O8 and a molecular weight of 313.19 g/mol. Its IUPAC name is nitro-[3-(5-nitro-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-5-yl]azanide;tetrahydrate.
| Compound Name | nitro-[3-(5-nitro-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-5-yl]azanide;tetrahydrate |
|---|---|
| PubChem CID | 139159659 |
| Molecular Formula | C4H11N9O8 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | nitro-[3-(5-nitro-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-5-yl]azanide;tetrahydrate |
| SMILES | O.O.O.O.O=[N+]([O-])[N-]c1nc(-c2n[nH]c([N+](=O)[O-])[nH+]2)n[nH]1 |
| InChI | InChI=1S/C4H2N9O4.4H2O/c14-12(15)4-6-2(8-10-4)1-5-3(9-7-1)11-13(16)17;;;;/h(H2-,5,6,7,8,9,10,11);4*1H2/q-1;;;;/p+1 |
| InChIKey | HGUBOMUDCWQEPS-UHFFFAOYSA-O |
| XLogP | -4.18 |
| TPSA | 310.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|