C34H12BF20OP — CID 139160058
trans-(4R,6R)-4-methyl-2,2,5,5-tetrakis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1-oxa-5-phosphonia-2-boranuidacyclohexane (PubChem CID 139160058) has the molecular formula C34H12BF20OP and a molecular weight of 858.21 g/mol. Its IUPAC name is trans-(4R,6R)-4-methyl-2,2,5,5-tetrakis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1-oxa-5-phosphonia-2-boranuidacyclohexane.
| Compound Name | trans-(4R,6R)-4-methyl-2,2,5,5-tetrakis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1-oxa-5-phosphonia-2-boranuidacyclohexane |
|---|---|
| PubChem CID | 139160058 |
| Molecular Formula | C34H12BF20OP |
| Molecular Weight | 858.21 g/mol |
| Exact Mass | 858.04 |
| IUPAC Name | trans-(4R,6R)-4-methyl-2,2,5,5-tetrakis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1-oxa-5-phosphonia-2-boranuidacyclohexane |
| SMILES | C[C@@H]1C[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)O[C@@H](c2ccccc2)[P+]1(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C34H12BF20OP/c1-8-7-35(10-12(36)16(40)20(44)17(41)13(10)37,11-14(38)18(42)21(45)19(43)15(11)39)56-34(9-5-3-2-4-6-9)57(8,32-28(52)24(48)22(46)25(49)29(32)53)33-30(54)26(50)23(47)27(51)31(33)55/h2-6,8,34H,7H2,1H3/t8-,34-/m1/s1 |
| InChIKey | FIOYVTGTZVNSAJ-UPJQFLLNSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.21 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|