About CID 139161054
CID 139161054 (PubChem CID 139161054) has the molecular formula C35H45F3GeN2OS
and a molecular weight of 671.43 g/mol.
Molecular Properties
| Compound Name | CID 139161054 |
| PubChem CID | 139161054 |
| Molecular Formula | C35H45F3GeN2OS |
| Molecular Weight | 671.43 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | — |
| SMILES | C/C(=C/C(C)=N/c1c(C(C)C)cccc1C(C)C)N([Ge]O[C@H](c1cccs1)C(F)(F)F)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C35H45F3GeN2OS/c1-21(2)27-14-11-15-28(22(3)4)32(27)40-25(9)20-26(10)41(33-29(23(5)6)16-12-17-30(33)24(7)8)39-42-34(35(36,37)38)31-18-13-19-43-31/h11-24,34H,1-10H3/b26-20-,40-25+/t34-/m1/s1 |
| InChIKey | VWVPPOBFRFNTPW-UFRFPENNSA-N |
| XLogP | 11.60 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 671.43 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 139161054 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139161054?
The IUPAC name of CID 139161054 (CID 139161054) is not available.
What is the SMILES notation for CID 139161054?
The canonical SMILES for CID 139161054 is C/C(=C/C(C)=N/c1c(C(C)C)cccc1C(C)C)N([Ge]O[C@H](c1cccs1)C(F)(F)F)c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of CID 139161054?
The InChIKey is VWVPPOBFRFNTPW-UFRFPENNSA-N. The full InChI is InChI=1S/C35H45F3GeN2OS/c1-21(2)27-14-11-15-28(22(3)4)32(27)40-25(9)20-26(10)41(33-29(23(5)6)16-12-17-30(33)24(7)8)39-42-34(35(36,37)38)31-18-13-19-43-31/h11-24,34H,1-10H3/b26-20-,40-25+/t34-/m1/s1.
What are the key properties of CID 139161054?
CID 139161054 has a molecular weight of 671.43 g/mol, XLogP of 11.60, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139161054 is sourced from PubChem (CID 139161054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).