C25H22N6O3 — CID 139161129
2-[(3S)-2-(2-hydroxyphenyl)-3-methoxy-1,4-dipyridin-2-yl-3H-1,2,4,5-tetrazin-6-yl]phenol (PubChem CID 139161129) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-[(3S)-2-(2-hydroxyphenyl)-3-methoxy-1,4-dipyridin-2-yl-3H-1,2,4,5-tetrazin-6-yl]phenol.
| Compound Name | 2-[(3S)-2-(2-hydroxyphenyl)-3-methoxy-1,4-dipyridin-2-yl-3H-1,2,4,5-tetrazin-6-yl]phenol |
|---|---|
| PubChem CID | 139161129 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[(3S)-2-(2-hydroxyphenyl)-3-methoxy-1,4-dipyridin-2-yl-3H-1,2,4,5-tetrazin-6-yl]phenol |
| SMILES | CO[C@@H]1N(c2ccccn2)N=C(c2ccccc2O)N(c2ccccn2)N1c1ccccc1O |
| InChI | InChI=1S/C25H22N6O3/c1-34-25-29(22-14-6-8-16-26-22)28-24(18-10-2-4-12-20(18)32)31(23-15-7-9-17-27-23)30(25)19-11-3-5-13-21(19)33/h2-17,25,32-33H,1H3/t25-/m1/s1 |
| InChIKey | LAGSFTBCUQBMBO-RUZDIDTESA-N |
| XLogP | 3.93 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|