C24H20MnN6O2 — CID 139161130
manganese(2+);bis(2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate) (PubChem CID 139161130) has the molecular formula C24H20MnN6O2 and a molecular weight of 479.40 g/mol. Its IUPAC name is manganese(2+);bis(2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate).
| Compound Name | manganese(2+);bis(2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate) |
|---|---|
| PubChem CID | 139161130 |
| Molecular Formula | C24H20MnN6O2 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | manganese(2+);bis(2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate) |
| SMILES | [Mn+2].[O-]c1ccccc1/C=N/Nc1ccccn1.[O-]c1ccccc1/C=N/Nc1ccccn1 |
| InChI | InChI=1S/2C12H11N3O.Mn/c2*16-11-6-2-1-5-10(11)9-14-15-12-7-3-4-8-13-12;/h2*1-9,16H,(H,13,15);/q;;+2/p-2/b2*14-9+; |
| InChIKey | NFPVTUFKOBMCEW-ZNVPEIAMSA-L |
| XLogP | 3.20 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|