C35H23BN2O2 — CID 139161521
1-(4-carbazol-9-ylphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene (PubChem CID 139161521) has the molecular formula C35H23BN2O2 and a molecular weight of 514.39 g/mol. Its IUPAC name is 1-(4-carbazol-9-ylphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene.
| Compound Name | 1-(4-carbazol-9-ylphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 139161521 |
| Molecular Formula | C35H23BN2O2 |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 1-(4-carbazol-9-ylphenyl)-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaene |
| SMILES | c1ccc2c(c1)O[B-]1(c3ccc(-n4c5ccccc5c5ccccc54)cc3)Oc3ccccc3-c3cccc-2[n+]31 |
| InChI | InChI=1S/C35H23BN2O2/c1-5-14-30-26(10-1)27-11-2-6-15-31(27)37(30)25-22-20-24(21-23-25)36-38-32(28-12-3-7-18-34(28)39-36)16-9-17-33(38)29-13-4-8-19-35(29)40-36/h1-23H |
| InChIKey | CHHBAYYIMZPQIX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|