C39H32BF10OP — CID 139161815
(6R)-2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-5,5-bis(2,4,6-trimethylphenyl)-1-oxa-5-phosphonia-2-boranuidacyclohexane (PubChem CID 139161815) has the molecular formula C39H32BF10OP and a molecular weight of 748.45 g/mol. Its IUPAC name is (6R)-2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-5,5-bis(2,4,6-trimethylphenyl)-1-oxa-5-phosphonia-2-boranuidacyclohexane.
| Compound Name | (6R)-2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-5,5-bis(2,4,6-trimethylphenyl)-1-oxa-5-phosphonia-2-boranuidacyclohexane |
|---|---|
| PubChem CID | 139161815 |
| Molecular Formula | C39H32BF10OP |
| Molecular Weight | 748.45 g/mol |
| Exact Mass | 748.21 |
| IUPAC Name | (6R)-2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-5,5-bis(2,4,6-trimethylphenyl)-1-oxa-5-phosphonia-2-boranuidacyclohexane |
| SMILES | Cc1cc(C)c([P+]2(c3c(C)cc(C)cc3C)CC[B-](c3c(F)c(F)c(F)c(F)c3F)(c3c(F)c(F)c(F)c(F)c3F)O[C@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C39H32BF10OP/c1-18-14-20(3)37(21(4)15-18)52(38-22(5)16-19(2)17-23(38)6)13-12-40(51-39(52)24-10-8-7-9-11-24,25-27(41)31(45)35(49)32(46)28(25)42)26-29(43)33(47)36(50)34(48)30(26)44/h7-11,14-17,39H,12-13H2,1-6H3/t39-/m1/s1 |
| InChIKey | QRPQDWUVPLQKMZ-LDLOPFEMSA-N |
| XLogP | 9.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.45 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|