C11H15N — CID 139162240
(3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine (PubChem CID 139162240) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine.
| Compound Name | (3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine |
|---|---|
| PubChem CID | 139162240 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3R)-N,N,3-trimethyl-2,3-dihydropentalen-1-amine |
| SMILES | C[C@@H]1CC(N(C)C)=C2C=CC=C21 |
| InChI | InChI=1S/C11H15N/c1-8-7-11(12(2)3)10-6-4-5-9(8)10/h4-6,8H,7H2,1-3H3/t8-/m1/s1 |
| InChIKey | AUAUNQBYGZFTAF-MRVPVSSYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |