C8H12Cl2F6GeN4O2 — CID 139162315
[dichloro-[(Z)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxygermyl] (1Z)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate (PubChem CID 139162315) has the molecular formula C8H12Cl2F6GeN4O2 and a molecular weight of 453.71 g/mol. Its IUPAC name is [dichloro-[(Z)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxygermyl] (1Z)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate.
| Compound Name | [dichloro-[(Z)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxygermyl] (1Z)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate |
|---|---|
| PubChem CID | 139162315 |
| Molecular Formula | C8H12Cl2F6GeN4O2 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | [dichloro-[(Z)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxygermyl] (1Z)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate |
| SMILES | CN(C)/N=C(\O[Ge](Cl)(Cl)O/C(=N\N(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12Cl2F6GeN4O2/c1-20(2)18-5(7(11,12)13)22-17(9,10)23-6(8(14,15)16)19-21(3)4/h1-4H3/b18-5-,19-6- |
| InChIKey | AGRRRENZRWCHRK-GKIHVPCKSA-N |
| XLogP | 2.81 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|