C24H12N4O4 — CID 139162752
1,10-phenanthroline-5,6-dione (PubChem CID 139162752) has the molecular formula C24H12N4O4 and a molecular weight of 420.38 g/mol. Its IUPAC name is 1,10-phenanthroline-5,6-dione.
| Compound Name | 1,10-phenanthroline-5,6-dione |
|---|---|
| PubChem CID | 139162752 |
| Molecular Formula | C24H12N4O4 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1,10-phenanthroline-5,6-dione |
| SMILES | O=C1C(=O)c2cccnc2-c2ncccc21.O=C1C(=O)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/2C12H6N2O2/c2*15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10/h2*1-6H |
| InChIKey | KTJRFHNIRQYICU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 119.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|