C48H54CoN4O2 — CID 139163130
cobalt(2+);bis(2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate) (PubChem CID 139163130) has the molecular formula C48H54CoN4O2 and a molecular weight of 777.92 g/mol. Its IUPAC name is cobalt(2+);bis(2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate).
| Compound Name | cobalt(2+);bis(2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate) |
|---|---|
| PubChem CID | 139163130 |
| Molecular Formula | C48H54CoN4O2 |
| Molecular Weight | 777.92 g/mol |
| Exact Mass | 777.36 |
| IUPAC Name | cobalt(2+);bis(2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate) |
| SMILES | CC(C)(C)c1cc(/C=N/c2cccc3cccnc23)c([O-])c(C(C)(C)C)c1.CC(C)(C)c1cc(C=Nc2cccc3cccnc23)c([O-])c(C(C)(C)C)c1.[Co+2] |
| InChI | InChI=1S/2C24H28N2O.Co/c2*1-23(2,3)18-13-17(22(27)19(14-18)24(4,5)6)15-26-20-11-7-9-16-10-8-12-25-21(16)20;/h2*7-15,27H,1-6H3;/q;;+2/p-2/b26-15+;; |
| InChIKey | DGTKWYNQDODTQJ-JTRDKPPGSA-L |
| XLogP | 11.31 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.92 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|