C13H11N3O2S — CID 139163644
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 139163644) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139163644 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C13H11N3O2S/c17-11-6-2-1-4-9(11)8-15-16-12(18)10-5-3-7-14-13(10)19/h1-8,17H,(H,14,19)(H,16,18)/b15-8+ |
| InChIKey | WZBBRWRUZYDLTO-OVCLIPMQSA-N |
| XLogP | 2.21 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|