About erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine
erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine (PubChem CID 139163733) has the molecular formula C28H35ErN2O6
and a molecular weight of 662.86 g/mol. Its IUPAC name is erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine |
| PubChem CID | 139163733 |
| Molecular Formula | C28H35ErN2O6 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 661.18 |
| IUPAC Name | erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine |
| SMILES | CCC(=O)/C=C(/C)[O-].CCC(=O)/C=C(/C)[O-].CCC(=O)/C=C(/C)[O-].[Er+3].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.3C6H10O2.Er/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3*1-3-6(8)4-5(2)7;/h1-8H;3*4,7H,3H2,1-2H3;/q;;;;+3/p-3/b;3*5-4-; |
| InChIKey | XGDUUTXVUFHQRF-MCTJRNESSA-K |
| XLogP | 2.83 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine?
The IUPAC name of erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine (CID 139163733) is erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine.
What is the SMILES notation for erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine?
The canonical SMILES for erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine is CCC(=O)/C=C(/C)[O-].CCC(=O)/C=C(/C)[O-].CCC(=O)/C=C(/C)[O-].[Er+3].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine?
The InChIKey is XGDUUTXVUFHQRF-MCTJRNESSA-K. The full InChI is InChI=1S/C10H8N2.3C6H10O2.Er/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3*1-3-6(8)4-5(2)7;/h1-8H;3*4,7H,3H2,1-2H3;/q;;;;+3/p-3/b;3*5-4-;.
What are the key properties of erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine?
erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine has a molecular weight of 662.86 g/mol, XLogP of 2.83, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for erbium(3+);tris((Z)-4-oxohex-2-en-2-olate);2-pyridin-2-ylpyridine is sourced from PubChem (CID 139163733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).