About bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium
bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium (PubChem CID 139164403) has the molecular formula C19H15N2O3V-5
and a molecular weight of 370.28 g/mol. Its IUPAC name is bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium.
Molecular Properties
| Compound Name | bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium |
| PubChem CID | 139164403 |
| Molecular Formula | C19H15N2O3V-5 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium |
| SMILES | [O-2].[O-2].[O-]c1c(/C=N/Cc2ccccn2)cccc1-c1ccccc1.[V] |
| InChI | InChI=1S/C19H16N2O.2O.V/c22-19-16(13-20-14-17-10-4-5-12-21-17)9-6-11-18(19)15-7-2-1-3-8-15;;;/h1-13,22H,14H2;;;/q;2*-2;/p-1/b20-13+;;; |
| InChIKey | QGBKHSNSHFDGMN-CNMPVOTBSA-M |
| XLogP | 3.20 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium?
The IUPAC name of bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium (CID 139164403) is bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium.
What is the SMILES notation for bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium?
The canonical SMILES for bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium is [O-2].[O-2].[O-]c1c(/C=N/Cc2ccccn2)cccc1-c1ccccc1.[V].
What is the InChIKey of bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium?
The InChIKey is QGBKHSNSHFDGMN-CNMPVOTBSA-M. The full InChI is InChI=1S/C19H16N2O.2O.V/c22-19-16(13-20-14-17-10-4-5-12-21-17)9-6-11-18(19)15-7-2-1-3-8-15;;;/h1-13,22H,14H2;;;/q;2*-2;/p-1/b20-13+;;;.
What are the key properties of bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium?
bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium has a molecular weight of 370.28 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxygen(2-));2-phenyl-6-(pyridin-2-ylmethyliminomethyl)phenolate;vanadium is sourced from PubChem (CID 139164403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).