C44H38N6O4 — CID 139164454
8-(methoxymethoxy)-2-methyl-5,7-dipyridin-4-ylquinoline (PubChem CID 139164454) has the molecular formula C44H38N6O4 and a molecular weight of 714.83 g/mol. Its IUPAC name is 8-(methoxymethoxy)-2-methyl-5,7-dipyridin-4-ylquinoline.
| Compound Name | 8-(methoxymethoxy)-2-methyl-5,7-dipyridin-4-ylquinoline |
|---|---|
| PubChem CID | 139164454 |
| Molecular Formula | C44H38N6O4 |
| Molecular Weight | 714.83 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | 8-(methoxymethoxy)-2-methyl-5,7-dipyridin-4-ylquinoline |
| SMILES | COCOc1c(-c2ccncc2)cc(-c2ccncc2)c2ccc(C)nc12.COCOc1c(-c2ccncc2)cc(-c2ccncc2)c2ccc(C)nc12 |
| InChI | InChI=1S/2C22H19N3O2/c2*1-15-3-4-18-19(16-5-9-23-10-6-16)13-20(17-7-11-24-12-8-17)22(21(18)25-15)27-14-26-2/h2*3-13H,14H2,1-2H3 |
| InChIKey | DLBBAVNVOQQTGR-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.83 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|