C26H12BF15NP — CID 139164876
[(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide (PubChem CID 139164876) has the molecular formula C26H12BF15NP and a molecular weight of 665.15 g/mol. Its IUPAC name is [(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide.
| Compound Name | [(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139164876 |
| Molecular Formula | C26H12BF15NP |
| Molecular Weight | 665.15 g/mol |
| Exact Mass | 665.06 |
| IUPAC Name | [(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
| SMILES | C[C@H](C[B@@H-](c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1)P(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H12BF15NP/c1-8(7-27(43-5-3-2-4-6-43)9-10(28)12(30)14(32)13(31)11(9)29)44(25-21(39)17(35)15(33)18(36)22(25)40)26-23(41)19(37)16(34)20(38)24(26)42/h2-6,8,27H,7H2,1H3/t8-,27+/m1/s1 |
| InChIKey | CKRKXGSZCUMBOL-FZWUBBAYSA-N |
| XLogP | 6.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.15 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|