C14H18B2Br6N6O6-2 — CID 139165563
(3Z,5Z,10Z,18Z)-4,5,11,12,17,18-hexabromo-1,8-dibutyl-2,7,9,14,15,20-hexaoxa-3,6,10,13,16,19-hexaza-1,8-diboranuidabicyclo[6.6.6]icosa-3,5,10,12,16,18-hexaene (PubChem CID 139165563) has the molecular formula C14H18B2Br6N6O6-2 and a molecular weight of 867.38 g/mol. Its IUPAC name is (3Z,5Z,10Z,18Z)-4,5,11,12,17,18-hexabromo-1,8-dibutyl-2,7,9,14,15,20-hexaoxa-3,6,10,13,16,19-hexaza-1,8-diboranuidabicyclo[6.6.6]icosa-3,5,10,12,16,18-hexaene.
| Compound Name | (3Z,5Z,10Z,18Z)-4,5,11,12,17,18-hexabromo-1,8-dibutyl-2,7,9,14,15,20-hexaoxa-3,6,10,13,16,19-hexaza-1,8-diboranuidabicyclo[6.6.6]icosa-3,5,10,12,16,18-hexaene |
|---|---|
| PubChem CID | 139165563 |
| Molecular Formula | C14H18B2Br6N6O6-2 |
| Molecular Weight | 867.38 g/mol |
| Exact Mass | 861.66 |
| IUPAC Name | (3Z,5Z,10Z,18Z)-4,5,11,12,17,18-hexabromo-1,8-dibutyl-2,7,9,14,15,20-hexaoxa-3,6,10,13,16,19-hexaza-1,8-diboranuidabicyclo[6.6.6]icosa-3,5,10,12,16,18-hexaene |
| SMILES | CCCC[B-]12ON=C(Br)/C(Br)=N/O[B-](CCCC)(O/N=C(/Br)C(Br)=NO1)O/N=C(Br)\C(Br)=N\O2 |
| InChI | InChI=1S/C14H18B2Br6N6O6/c1-3-5-7-15-29-23-9(17)12(20)26-32-16(8-6-4-2,33-27-13(21)10(18)24-30-15)34-28-14(22)11(19)25-31-15/h3-8H2,1-2H3/q-2/b23-9-,24-10+,25-11+,26-12?,27-13-,28-14? |
| InChIKey | UUWXFBFOMXHGCV-PXYJCFNXSA-N |
| XLogP | 6.84 |
| TPSA | 129.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.38 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|