C67H62Cl2N8O6 — CID 139166071
dichloromethane;bis(1-(8-methoxyquinolin-2-yl)-N,N-bis[(8-methoxyquinolin-2-yl)methyl]methanamine) (PubChem CID 139166071) has the molecular formula C67H62Cl2N8O6 and a molecular weight of 1146.19 g/mol. Its IUPAC name is dichloromethane;bis(1-(8-methoxyquinolin-2-yl)-N,N-bis[(8-methoxyquinolin-2-yl)methyl]methanamine).
| Compound Name | dichloromethane;bis(1-(8-methoxyquinolin-2-yl)-N,N-bis[(8-methoxyquinolin-2-yl)methyl]methanamine) |
|---|---|
| PubChem CID | 139166071 |
| Molecular Formula | C67H62Cl2N8O6 |
| Molecular Weight | 1146.19 g/mol |
| Exact Mass | 1144.42 |
| IUPAC Name | dichloromethane;bis(1-(8-methoxyquinolin-2-yl)-N,N-bis[(8-methoxyquinolin-2-yl)methyl]methanamine) |
| SMILES | COc1cccc2ccc(CN(Cc3ccc4cccc(OC)c4n3)Cc3ccc4cccc(OC)c4n3)nc12.COc1cccc2ccc(CN(Cc3ccc4cccc(OC)c4n3)Cc3ccc4cccc(OC)c4n3)nc12.ClCCl |
| InChI | InChI=1S/2C33H30N4O3.CH2Cl2/c2*1-38-28-10-4-7-22-13-16-25(34-31(22)28)19-37(20-26-17-14-23-8-5-11-29(39-2)32(23)35-26)21-27-18-15-24-9-6-12-30(40-3)33(24)36-27;2-1-3/h2*4-18H,19-21H2,1-3H3;1H2 |
| InChIKey | PRAMVFFSACYGBL-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 139.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.19 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|