C12H10F5N2O4Re-7 — CID 139166159
1,2-dimethyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazol-1-ium;tetrakis(oxygen(2-));rhenium (PubChem CID 139166159) has the molecular formula C12H10F5N2O4Re-7 and a molecular weight of 527.42 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazol-1-ium;tetrakis(oxygen(2-));rhenium.
| Compound Name | 1,2-dimethyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazol-1-ium;tetrakis(oxygen(2-));rhenium |
|---|---|
| PubChem CID | 139166159 |
| Molecular Formula | C12H10F5N2O4Re-7 |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 1,2-dimethyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]imidazol-1-ium;tetrakis(oxygen(2-));rhenium |
| SMILES | Cc1n(Cc2c(F)c(F)c(F)c(F)c2F)cc[n+]1C.[O-2].[O-2].[O-2].[O-2].[Re] |
| InChI | InChI=1S/C12H10F5N2.4O.Re/c1-6-18(2)3-4-19(6)5-7-8(13)10(15)12(17)11(16)9(7)14;;;;;/h3-4H,5H2,1-2H3;;;;;/q+1;4*-2; |
| InChIKey | BIPDWSMGMSGNSP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|