About dippy
dippy (PubChem CID 139166816) has the molecular formula C34H24B2N2O2
and a molecular weight of 514.20 g/mol.
Molecular Properties
| Compound Name | dippy |
| PubChem CID | 139166816 |
| Molecular Formula | C34H24B2N2O2 |
| Molecular Weight | 514.20 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)O[B-]1(c3ccccc3[B-]3(Oc4ccccc4-c4cccc[n+]43)c3ccccc31)[n+]1ccccc1-2 |
| InChI | InChI=1S/C34H24B2N2O2/c1-7-21-33-25(13-1)31-19-9-11-23-37(31)35(39-33)27-15-3-5-17-29(27)36(30-18-6-4-16-28(30)35)38-24-12-10-20-32(38)26-14-2-8-22-34(26)40-36/h1-24H |
| InChIKey | JKQDJYXZIXAIFH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dippy with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dippy?
The IUPAC name of dippy (CID 139166816) is not available.
What is the SMILES notation for dippy?
The canonical SMILES for dippy is c1ccc2c(c1)O[B-]1(c3ccccc3[B-]3(Oc4ccccc4-c4cccc[n+]43)c3ccccc31)[n+]1ccccc1-2.
What is the InChIKey of dippy?
The InChIKey is JKQDJYXZIXAIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H24B2N2O2/c1-7-21-33-25(13-1)31-19-9-11-23-37(31)35(39-33)27-15-3-5-17-29(27)36(30-18-6-4-16-28(30)35)38-24-12-10-20-32(38)26-14-2-8-22-34(26)40-36/h1-24H.
What are the key properties of dippy?
dippy has a molecular weight of 514.20 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dippy is sourced from PubChem (CID 139166816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).