About CID 139166817
CID 139166817 (PubChem CID 139166817) has the molecular formula C50H34B2N4O2
and a molecular weight of 744.47 g/mol.
Molecular Properties
| Compound Name | CID 139166817 |
| PubChem CID | 139166817 |
| Molecular Formula | C50H34B2N4O2 |
| Molecular Weight | 744.47 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | — |
| SMILES | c1ccc(-n2c3[n+](c4ccccc42)[B-]2(Oc4ccccc4-3)c3ccccc3[B-]3(Oc4ccccc4-c4n(-c5ccccc5)c5ccccc5[n+]43)c3ccccc32)cc1 |
| InChI | InChI=1S/C50H34B2N4O2/c1-3-19-35(20-4-1)53-43-29-13-15-31-45(43)55-49(53)37-23-7-17-33-47(37)57-51(55)39-25-9-11-27-41(39)52(42-28-12-10-26-40(42)51)56-46-32-16-14-30-44(46)54(36-21-5-2-6-22-36)50(56)38-24-8-18-34-48(38)58-52/h1-34H |
| InChIKey | KSLMJALYHXVDJY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 744.47 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139166817 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139166817?
The IUPAC name of CID 139166817 (CID 139166817) is not available.
What is the SMILES notation for CID 139166817?
The canonical SMILES for CID 139166817 is c1ccc(-n2c3[n+](c4ccccc42)[B-]2(Oc4ccccc4-3)c3ccccc3[B-]3(Oc4ccccc4-c4n(-c5ccccc5)c5ccccc5[n+]43)c3ccccc32)cc1.
What is the InChIKey of CID 139166817?
The InChIKey is KSLMJALYHXVDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H34B2N4O2/c1-3-19-35(20-4-1)53-43-29-13-15-31-45(43)55-49(53)37-23-7-17-33-47(37)57-51(55)39-25-9-11-27-41(39)52(42-28-12-10-26-40(42)51)56-46-32-16-14-30-44(46)54(36-21-5-2-6-22-36)50(56)38-24-8-18-34-48(38)58-52/h1-34H.
What are the key properties of CID 139166817?
CID 139166817 has a molecular weight of 744.47 g/mol, XLogP of 6.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139166817 is sourced from PubChem (CID 139166817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).