About magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide
magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide (PubChem CID 139166925) has the molecular formula C16H39MgNSi2
and a molecular weight of 325.97 g/mol. Its IUPAC name is magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide.
Molecular Properties
| Compound Name | magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide |
| PubChem CID | 139166925 |
| Molecular Formula | C16H39MgNSi2 |
| Molecular Weight | 325.97 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide |
| SMILES | CC(C)[Si]([N-][Si](C)(C)C(C)(C)C)(C(C)C)C(C)C.[CH3-].[Mg+2] |
| InChI | InChI=1S/C15H36NSi2.CH3.Mg/c1-12(2)18(13(3)4,14(5)6)16-17(10,11)15(7,8)9;;/h12-14H,1-11H3;1H3;/q2*-1;+2 |
| InChIKey | LHWYQAVIBUAGNB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.97 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide?
The IUPAC name of magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide (CID 139166925) is magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide.
What is the SMILES notation for magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide?
The canonical SMILES for magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide is CC(C)[Si]([N-][Si](C)(C)C(C)(C)C)(C(C)C)C(C)C.[CH3-].[Mg+2].
What is the InChIKey of magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide?
The InChIKey is LHWYQAVIBUAGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H36NSi2.CH3.Mg/c1-12(2)18(13(3)4,14(5)6)16-17(10,11)15(7,8)9;;/h12-14H,1-11H3;1H3;/q2*-1;+2.
What are the key properties of magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide?
magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide has a molecular weight of 325.97 g/mol, XLogP of 6.61, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;[tert-butyl(dimethyl)silyl]-tri(propan-2-yl)silylazanide;carbanide is sourced from PubChem (CID 139166925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).