About bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+)
bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) (PubChem CID 139167213) has the molecular formula C36H50N4NiO2
and a molecular weight of 629.52 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+).
Molecular Properties
| Compound Name | bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) |
| PubChem CID | 139167213 |
| Molecular Formula | C36H50N4NiO2 |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) |
| SMILES | Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])n[nH]1.Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])n[nH]1.[Ni+2] |
| InChI | InChI=1S/2C18H26N2O.Ni/c2*1-11-8-15(20-19-11)13-9-12(17(2,3)4)10-14(16(13)21)18(5,6)7;/h2*8-10,21H,1-7H3,(H,19,20);/q;;+2/p-2 |
| InChIKey | ZMQJLBPRQNEWFR-UHFFFAOYSA-L |
| XLogP | 8.10 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+)?
The IUPAC name of bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) (CID 139167213) is bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+).
What is the SMILES notation for bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+)?
The canonical SMILES for bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) is Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])n[nH]1.Cc1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])n[nH]1.[Ni+2].
What is the InChIKey of bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+)?
The InChIKey is ZMQJLBPRQNEWFR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H26N2O.Ni/c2*1-11-8-15(20-19-11)13-9-12(17(2,3)4)10-14(16(13)21)18(5,6)7;/h2*8-10,21H,1-7H3,(H,19,20);/q;;+2/p-2.
What are the key properties of bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+)?
bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) has a molecular weight of 629.52 g/mol, XLogP of 8.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4-ditert-butyl-6-(5-methyl-1H-pyrazol-3-yl)phenolate);nickel(2+) is sourced from PubChem (CID 139167213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).