C31H25B2F18NO2 — CID 139167352
[4-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-1-ium-1-yl]-bis[2,4,6-tris(trifluoromethyl)phenyl]boranuide (PubChem CID 139167352) has the molecular formula C31H25B2F18NO2 and a molecular weight of 807.13 g/mol. Its IUPAC name is [4-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-1-ium-1-yl]-bis[2,4,6-tris(trifluoromethyl)phenyl]boranuide.
| Compound Name | [4-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-1-ium-1-yl]-bis[2,4,6-tris(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139167352 |
| Molecular Formula | C31H25B2F18NO2 |
| Molecular Weight | 807.13 g/mol |
| Exact Mass | 807.18 |
| IUPAC Name | [4-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-1-ium-1-yl]-bis[2,4,6-tris(trifluoromethyl)phenyl]boranuide |
| SMILES | Cc1cc[n+]([BH-](c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c(CB2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C31H25B2F18NO2/c1-14-6-7-52(17(8-14)13-32-53-24(2,3)25(4,5)54-32)33(22-18(28(40,41)42)9-15(26(34,35)36)10-19(22)29(43,44)45)23-20(30(46,47)48)11-16(27(37,38)39)12-21(23)31(49,50)51/h6-12,33H,13H2,1-5H3 |
| InChIKey | JRLHBRTYQGQNRF-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.13 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|