C32H20BCuF12N6 — CID 139167636
copper(1+);ethene;tris[5-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]boranuide (PubChem CID 139167636) has the molecular formula C32H20BCuF12N6 and a molecular weight of 790.89 g/mol. Its IUPAC name is copper(1+);ethene;tris[5-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]boranuide.
| Compound Name | copper(1+);ethene;tris[5-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139167636 |
| Molecular Formula | C32H20BCuF12N6 |
| Molecular Weight | 790.89 g/mol |
| Exact Mass | 790.09 |
| IUPAC Name | copper(1+);ethene;tris[5-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]boranuide |
| SMILES | C=C.Fc1ccc(-c2cc(C(F)(F)F)nn2[BH-](n2nc(C(F)(F)F)cc2-c2ccc(F)cc2)n2nc(C(F)(F)F)cc2-c2ccc(F)cc2)cc1.[Cu+] |
| InChI | InChI=1S/C30H16BF12N6.C2H4.Cu/c32-19-7-1-16(2-8-19)22-13-25(28(35,36)37)44-47(22)31(48-23(14-26(45-48)29(38,39)40)17-3-9-20(33)10-4-17)49-24(15-27(46-49)30(41,42)43)18-5-11-21(34)12-6-18;1-2;/h1-15,31H;1-2H2;/q-1;;+1 |
| InChIKey | CDCVQRBJCYBOKS-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.89 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|