C4H8N10O2 — CID 139167849
aminoazanium;4-[(E)-(5-oxo-1H-1,2,4-triazol-4-yl)diazenyl]-1,2,4-triazol-3-olate (PubChem CID 139167849) has the molecular formula C4H8N10O2 and a molecular weight of 228.18 g/mol. Its IUPAC name is aminoazanium;4-[(E)-(5-oxo-1H-1,2,4-triazol-4-yl)diazenyl]-1,2,4-triazol-3-olate.
| Compound Name | aminoazanium;4-[(E)-(5-oxo-1H-1,2,4-triazol-4-yl)diazenyl]-1,2,4-triazol-3-olate |
|---|---|
| PubChem CID | 139167849 |
| Molecular Formula | C4H8N10O2 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | aminoazanium;4-[(E)-(5-oxo-1H-1,2,4-triazol-4-yl)diazenyl]-1,2,4-triazol-3-olate |
| SMILES | N[NH3+].O=c1[nH]ncn1/N=N/n1cnnc1[O-] |
| InChI | InChI=1S/C4H4N8O2.H4N2/c13-3-7-5-1-11(3)9-10-12-2-6-8-4(12)14;1-2/h1-2H,(H,7,13)(H,8,14);1-2H2/b10-9+; |
| InChIKey | QBTNALDKMLTDJB-RRABGKBLSA-N |
| XLogP | -3.98 |
| TPSA | 182.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|