C19H15BF2N2O2 — CID 139168210
2,2-difluoro-8-methoxy-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene (PubChem CID 139168210) has the molecular formula C19H15BF2N2O2 and a molecular weight of 352.15 g/mol. Its IUPAC name is 2,2-difluoro-8-methoxy-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene.
| Compound Name | 2,2-difluoro-8-methoxy-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 139168210 |
| Molecular Formula | C19H15BF2N2O2 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2,2-difluoro-8-methoxy-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
| SMILES | COc1cc2[n+](cn1)[B-](F)(F)OC(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C19H15BF2N2O2/c1-25-17-12-16-18(14-8-4-2-5-9-14)19(15-10-6-3-7-11-15)26-20(21,22)24(16)13-23-17/h2-13H,1H3 |
| InChIKey | LKTXBQVCMIIPRG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|