About acetonitrilium;hexafluoroarsenic(1-)
acetonitrilium;hexafluoroarsenic(1-) (PubChem CID 139168472) has the molecular formula C2H4AsF6N
and a molecular weight of 230.97 g/mol. Its IUPAC name is acetonitrilium;hexafluoroarsenic(1-).
Molecular Properties
| Compound Name | acetonitrilium;hexafluoroarsenic(1-) |
| PubChem CID | 139168472 |
| Molecular Formula | C2H4AsF6N |
| Molecular Weight | 230.97 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | acetonitrilium;hexafluoroarsenic(1-) |
| SMILES | CC#[NH+].F[As-](F)(F)(F)(F)F |
| InChI | InChI=1S/C2H3N.AsF6/c1-2-3;2-1(3,4,5,6)7/h1H3;/q;-1/p+1 |
| InChIKey | ULJFHBOLKPYOEN-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 23.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.97 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetonitrilium;hexafluoroarsenic(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrilium;hexafluoroarsenic(1-)?
The IUPAC name of acetonitrilium;hexafluoroarsenic(1-) (CID 139168472) is acetonitrilium;hexafluoroarsenic(1-).
What is the SMILES notation for acetonitrilium;hexafluoroarsenic(1-)?
The canonical SMILES for acetonitrilium;hexafluoroarsenic(1-) is CC#[NH+].F[As-](F)(F)(F)(F)F.
What is the InChIKey of acetonitrilium;hexafluoroarsenic(1-)?
The InChIKey is ULJFHBOLKPYOEN-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H3N.AsF6/c1-2-3;2-1(3,4,5,6)7/h1H3;/q;-1/p+1.
What are the key properties of acetonitrilium;hexafluoroarsenic(1-)?
acetonitrilium;hexafluoroarsenic(1-) has a molecular weight of 230.97 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrilium;hexafluoroarsenic(1-) is sourced from PubChem (CID 139168472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).