C43H52N4O3Zn — CID 139169200
zinc;2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenazin-2-yl]iminomethyl]phenolate;methanol (PubChem CID 139169200) has the molecular formula C43H52N4O3Zn and a molecular weight of 738.30 g/mol. Its IUPAC name is zinc;2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenazin-2-yl]iminomethyl]phenolate;methanol.
| Compound Name | zinc;2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenazin-2-yl]iminomethyl]phenolate;methanol |
|---|---|
| PubChem CID | 139169200 |
| Molecular Formula | C43H52N4O3Zn |
| Molecular Weight | 738.30 g/mol |
| Exact Mass | 736.33 |
| IUPAC Name | zinc;2,4-ditert-butyl-6-[[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]phenazin-2-yl]iminomethyl]phenolate;methanol |
| SMILES | CC(C)(C)c1cc(/C=N/c2cc3nc4ccccc4nc3cc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.CO.[Zn+2] |
| InChI | InChI=1S/C42H50N4O2.CH4O.Zn/c1-39(2,3)27-17-25(37(47)29(19-27)41(7,8)9)23-43-33-21-35-36(46-32-16-14-13-15-31(32)45-35)22-34(33)44-24-26-18-28(40(4,5)6)20-30(38(26)48)42(10,11)12;1-2;/h13-24,47-48H,1-12H3;2H,1H3;/q;;+2/p-2/b43-23+,44-24+;; |
| InChIKey | MQXREVYYBDIUOZ-JNLAJAHESA-L |
| XLogP | 9.23 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.30 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|