C29H39F3N2O3STe — CID 139170075
1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methyltellanylimidazol-1-ium;trifluoromethanesulfonate (PubChem CID 139170075) has the molecular formula C29H39F3N2O3STe and a molecular weight of 680.30 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methyltellanylimidazol-1-ium;trifluoromethanesulfonate.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methyltellanylimidazol-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139170075 |
| Molecular Formula | C29H39F3N2O3STe |
| Molecular Weight | 680.30 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-methyltellanylimidazol-1-ium;trifluoromethanesulfonate |
| SMILES | C[Te]c1n(-c2c(C(C)C)cccc2C(C)C)cc[n+]1-c1c(C(C)C)cccc1C(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H39N2Te.CHF3O3S/c1-18(2)22-12-10-13-23(19(3)4)26(22)29-16-17-30(28(29)31-9)27-24(20(5)6)14-11-15-25(27)21(7)8;2-1(3,4)8(5,6)7/h10-21H,1-9H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AQPHEBYYMQOPPJ-UHFFFAOYSA-M |
| XLogP | 6.68 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.30 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|