About cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide
cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide (PubChem CID 139170668) has the molecular formula C10H15P-2
and a molecular weight of 166.20 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide |
| PubChem CID | 139170668 |
| Molecular Formula | C10H15P-2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide |
| SMILES | CC(C)(C)C[P-]c1ccc[cH-]1 |
| InChI | InChI=1S/C10H15P/c1-10(2,3)8-11-9-6-4-5-7-9/h4-7H,8H2,1-3H3/q-2 |
| InChIKey | LTYKQPUWPKYGPD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide?
The IUPAC name of cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide (CID 139170668) is cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide.
What is the SMILES notation for cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide?
The canonical SMILES for cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide is CC(C)(C)C[P-]c1ccc[cH-]1.
What is the InChIKey of cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide?
The InChIKey is LTYKQPUWPKYGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15P/c1-10(2,3)8-11-9-6-4-5-7-9/h4-7H,8H2,1-3H3/q-2.
What are the key properties of cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide?
cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide has a molecular weight of 166.20 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yl(2,2-dimethylpropyl)phosphanide is sourced from PubChem (CID 139170668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).