C33H23F15N4O2 — CID 139170854
N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide;oxolane (PubChem CID 139170854) has the molecular formula C33H23F15N4O2 and a molecular weight of 792.54 g/mol. Its IUPAC name is N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide;oxolane.
| Compound Name | N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide;oxolane |
|---|---|
| PubChem CID | 139170854 |
| Molecular Formula | C33H23F15N4O2 |
| Molecular Weight | 792.54 g/mol |
| Exact Mass | 792.16 |
| IUPAC Name | N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide;oxolane |
| SMILES | C1CCOC1.O=C(Nc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H15F15N4O.C4H8O/c30-23(31,24(32,33)25(34,35)26(36,37)27(38,39)28(40,41)29(42,43)44)22(49)47-17-9-7-15(8-10-17)16-13-20(18-5-1-3-11-45-18)48-21(14-16)19-6-2-4-12-46-19;1-2-4-5-3-1/h1-14H,(H,47,49);1-4H2 |
| InChIKey | OBPSARVXSDNFEG-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.54 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|