C58H30F30N8O2 — CID 139170858
N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide (PubChem CID 139170858) has the molecular formula C58H30F30N8O2 and a molecular weight of 1440.87 g/mol. Its IUPAC name is N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide.
| Compound Name | N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
|---|---|
| PubChem CID | 139170858 |
| Molecular Formula | C58H30F30N8O2 |
| Molecular Weight | 1440.87 g/mol |
| Exact Mass | 1440.20 |
| IUPAC Name | N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
| SMILES | O=C(Nc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=C(Nc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C29H15F15N4O/c2*30-23(31,24(32,33)25(34,35)26(36,37)27(38,39)28(40,41)29(42,43)44)22(49)47-17-9-7-15(8-10-17)16-13-20(18-5-1-3-11-45-18)48-21(14-16)19-6-2-4-12-46-19/h2*1-14H,(H,47,49) |
| InChIKey | BBVQETFFLQPBTM-UHFFFAOYSA-N |
| XLogP | 18.37 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1440.87 |
| LogP ≤ 5 | 18.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|