C27H29CuF3N2O4 — CID 139170909
copper;2-[[(3-tert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-6-(trifluoromethyl)phenolate;acetate (PubChem CID 139170909) has the molecular formula C27H29CuF3N2O4 and a molecular weight of 566.08 g/mol. Its IUPAC name is copper;2-[[(3-tert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-6-(trifluoromethyl)phenolate;acetate.
| Compound Name | copper;2-[[(3-tert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-6-(trifluoromethyl)phenolate;acetate |
|---|---|
| PubChem CID | 139170909 |
| Molecular Formula | C27H29CuF3N2O4 |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | copper;2-[[(3-tert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]-6-(trifluoromethyl)phenolate;acetate |
| SMILES | CC(=O)[O-].CC(C)(C)c1cccc(CN(Cc2ccccn2)Cc2cccc(C(F)(F)F)c2[O-])c1O.[Cu+2] |
| InChI | InChI=1S/C25H27F3N2O2.C2H4O2.Cu/c1-24(2,3)20-11-6-8-17(22(20)31)14-30(16-19-10-4-5-13-29-19)15-18-9-7-12-21(23(18)32)25(26,27)28;1-2(3)4;/h4-13,31-32H,14-16H2,1-3H3;1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | YSLLTAZMLLJUNK-UHFFFAOYSA-L |
| XLogP | 4.13 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|